C7H10NO+ — CID 4271972
1,2-dimethylpyridin-1-ium-3-ol (PubChem CID 4271972) has the molecular formula C7H10NO+ and a molecular weight of 124.16 g/mol. Its IUPAC name is 1,2-dimethylpyridin-1-ium-3-ol.
| Compound Name | 1,2-dimethylpyridin-1-ium-3-ol |
|---|---|
| PubChem CID | 4271972 |
| Molecular Formula | C7H10NO+ |
| Molecular Weight | 124.16 g/mol |
| Exact Mass | 124.08 |
| IUPAC Name | 1,2-dimethylpyridin-1-ium-3-ol |
| SMILES | Cc1c(O)ccc[n+]1C |
| InChI | InChI=1S/C7H9NO/c1-6-7(9)4-3-5-8(6)2/h3-5H,1-2H3/p+1 |
| InChIKey | NHMNCXOWPXIMRV-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.16 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|