C12H26N+ — CID 161162083
1,2-dimethylpyridin-1-ium;ethane;methane (PubChem CID 161162083) has the molecular formula C12H26N+ and a molecular weight of 184.35 g/mol. Its IUPAC name is 1,2-dimethylpyridin-1-ium;ethane;methane.
| Compound Name | 1,2-dimethylpyridin-1-ium;ethane;methane |
|---|---|
| PubChem CID | 161162083 |
| Molecular Formula | C12H26N+ |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.21 |
| IUPAC Name | 1,2-dimethylpyridin-1-ium;ethane;methane |
| SMILES | C.CC.CC.Cc1cccc[n+]1C |
| InChI | InChI=1S/C7H10N.2C2H6.CH4/c1-7-5-3-4-6-8(7)2;2*1-2;/h3-6H,1-2H3;2*1-2H3;1H4/q+1;;; |
| InChIKey | DXJBAKIEFUHMOW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|