About ethane;1-hydroxy-2-methylpyridin-1-ium;methane
ethane;1-hydroxy-2-methylpyridin-1-ium;methane (PubChem CID 159708216) has the molecular formula C10H22NO+
and a molecular weight of 172.29 g/mol. Its IUPAC name is ethane;1-hydroxy-2-methylpyridin-1-ium;methane.
Molecular Properties
| Compound Name | ethane;1-hydroxy-2-methylpyridin-1-ium;methane |
| PubChem CID | 159708216 |
| Molecular Formula | C10H22NO+ |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | ethane;1-hydroxy-2-methylpyridin-1-ium;methane |
| SMILES | C.C.CC.Cc1cccc[n+]1O |
| InChI | InChI=1S/C6H8NO.C2H6.2CH4/c1-6-4-2-3-5-7(6)8;1-2;;/h2-5,8H,1H3;1-2H3;2*1H4/q+1;;; |
| InChIKey | MYMMCFWUSJKOSD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-hydroxy-2-methylpyridin-1-ium;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-hydroxy-2-methylpyridin-1-ium;methane?
The IUPAC name of ethane;1-hydroxy-2-methylpyridin-1-ium;methane (CID 159708216) is ethane;1-hydroxy-2-methylpyridin-1-ium;methane.
What is the SMILES notation for ethane;1-hydroxy-2-methylpyridin-1-ium;methane?
The canonical SMILES for ethane;1-hydroxy-2-methylpyridin-1-ium;methane is C.C.CC.Cc1cccc[n+]1O.
What is the InChIKey of ethane;1-hydroxy-2-methylpyridin-1-ium;methane?
The InChIKey is MYMMCFWUSJKOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NO.C2H6.2CH4/c1-6-4-2-3-5-7(6)8;1-2;;/h2-5,8H,1H3;1-2H3;2*1H4/q+1;;;.
What are the key properties of ethane;1-hydroxy-2-methylpyridin-1-ium;methane?
ethane;1-hydroxy-2-methylpyridin-1-ium;methane has a molecular weight of 172.29 g/mol, XLogP of 2.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-hydroxy-2-methylpyridin-1-ium;methane is sourced from PubChem (CID 159708216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).