About ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium
ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium (PubChem CID 167521657) has the molecular formula C11H15N2O+
and a molecular weight of 191.25 g/mol. Its IUPAC name is ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium.
Molecular Properties
| Compound Name | ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium |
| PubChem CID | 167521657 |
| Molecular Formula | C11H15N2O+ |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium |
| SMILES | CC.Cc1cncc2ccc[n+](O)c12 |
| InChI | InChI=1S/C9H9N2O.C2H6/c1-7-5-10-6-8-3-2-4-11(12)9(7)8;1-2/h2-6,12H,1H3;1-2H3/q+1; |
| InChIKey | HDUNDRDXVYSUQO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium?
The IUPAC name of ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium (CID 167521657) is ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium.
What is the SMILES notation for ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium?
The canonical SMILES for ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium is CC.Cc1cncc2ccc[n+](O)c12.
What is the InChIKey of ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium?
The InChIKey is HDUNDRDXVYSUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N2O.C2H6/c1-7-5-10-6-8-3-2-4-11(12)9(7)8;1-2/h2-6,12H,1H3;1-2H3/q+1;.
What are the key properties of ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium?
ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium has a molecular weight of 191.25 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-hydroxy-8-methyl-1,6-naphthyridin-1-ium is sourced from PubChem (CID 167521657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).