About 4-methylquinolizin-5-ium bromide
4-methylquinolizin-5-ium bromide (PubChem CID 163564442) has the molecular formula C10H10BrN
and a molecular weight of 224.10 g/mol. Its IUPAC name is 4-methylquinolizin-5-ium bromide.
Molecular Properties
| Compound Name | 4-methylquinolizin-5-ium bromide |
| PubChem CID | 163564442 |
| Molecular Formula | C10H10BrN |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 4-methylquinolizin-5-ium bromide |
| SMILES | Cc1cccc2cccc[n+]12.[Br-] |
| InChI | InChI=1S/C10H10N.BrH/c1-9-5-4-7-10-6-2-3-8-11(9)10;/h2-8H,1H3;1H/q+1;/p-1 |
| InChIKey | FTZNXNYLSASNRZ-UHFFFAOYSA-M |
| XLogP | -1.26 |
| TPSA | 4.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylquinolizin-5-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylquinolizin-5-ium bromide?
The IUPAC name of 4-methylquinolizin-5-ium bromide (CID 163564442) is 4-methylquinolizin-5-ium bromide.
What is the SMILES notation for 4-methylquinolizin-5-ium bromide?
The canonical SMILES for 4-methylquinolizin-5-ium bromide is Cc1cccc2cccc[n+]12.[Br-].
What is the InChIKey of 4-methylquinolizin-5-ium bromide?
The InChIKey is FTZNXNYLSASNRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10N.BrH/c1-9-5-4-7-10-6-2-3-8-11(9)10;/h2-8H,1H3;1H/q+1;/p-1.
What are the key properties of 4-methylquinolizin-5-ium bromide?
4-methylquinolizin-5-ium bromide has a molecular weight of 224.10 g/mol, XLogP of -1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylquinolizin-5-ium bromide is sourced from PubChem (CID 163564442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).