C15H24BrN2O2S+ — CID 176696276
2-bromo-1,3-thiazole-4-carboxylic acid;1,2-dimethylpyridin-1-ium;ethane (PubChem CID 176696276) has the molecular formula C15H24BrN2O2S+ and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-bromo-1,3-thiazole-4-carboxylic acid;1,2-dimethylpyridin-1-ium;ethane.
| Compound Name | 2-bromo-1,3-thiazole-4-carboxylic acid;1,2-dimethylpyridin-1-ium;ethane |
|---|---|
| PubChem CID | 176696276 |
| Molecular Formula | C15H24BrN2O2S+ |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-bromo-1,3-thiazole-4-carboxylic acid;1,2-dimethylpyridin-1-ium;ethane |
| SMILES | CC.CC.Cc1cccc[n+]1C.O=C(O)c1csc(Br)n1 |
| InChI | InChI=1S/C7H10N.C4H2BrNO2S.2C2H6/c1-7-5-3-4-6-8(7)2;5-4-6-2(1-9-4)3(7)8;2*1-2/h3-6H,1-2H3;1H,(H,7,8);2*1-2H3/q+1;;; |
| InChIKey | OLPYYLDALVASSR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|