C18H16N2+2 — CID 123562585
1,12-dimethylbenzo[f][1,10]phenanthroline-1,12-diium (PubChem CID 123562585) has the molecular formula C18H16N2+2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1,12-dimethylbenzo[f][1,10]phenanthroline-1,12-diium.
| Compound Name | 1,12-dimethylbenzo[f][1,10]phenanthroline-1,12-diium |
|---|---|
| PubChem CID | 123562585 |
| Molecular Formula | C18H16N2+2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1,12-dimethylbenzo[f][1,10]phenanthroline-1,12-diium |
| SMILES | C[n+]1cccc2c3ccccc3c3ccc[n+](C)c3c21 |
| InChI | InChI=1S/C18H16N2/c1-19-11-5-9-15-13-7-3-4-8-14(13)16-10-6-12-20(2)18(16)17(15)19/h3-12H,1-2H3/q+2 |
| InChIKey | NNBJEWUYMGNPKV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|