C27H36N+ — CID 158329451
ethane;1,5,6,7,8,12-hexamethylphenanthro[9,10-b]pyridin-1-ium (PubChem CID 158329451) has the molecular formula C27H36N+ and a molecular weight of 374.59 g/mol. Its IUPAC name is ethane;1,5,6,7,8,12-hexamethylphenanthro[9,10-b]pyridin-1-ium.
| Compound Name | ethane;1,5,6,7,8,12-hexamethylphenanthro[9,10-b]pyridin-1-ium |
|---|---|
| PubChem CID | 158329451 |
| Molecular Formula | C27H36N+ |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | ethane;1,5,6,7,8,12-hexamethylphenanthro[9,10-b]pyridin-1-ium |
| SMILES | CC.CC.Cc1c(C)c(C)c2c3ccc[n+](C)c3c3c(C)cccc3c2c1C |
| InChI | InChI=1S/C23H24N.2C2H6/c1-13-9-7-10-18-20(13)23-19(11-8-12-24(23)6)22-17(5)15(3)14(2)16(4)21(18)22;2*1-2/h7-12H,1-6H3;2*1-2H3/q+1;; |
| InChIKey | SKRXZHRSYZVIFN-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|