About 4,5-dimethylphenanthridin-5-ium;ethane
4,5-dimethylphenanthridin-5-ium;ethane (PubChem CID 142008491) has the molecular formula C17H20N+
and a molecular weight of 238.35 g/mol. Its IUPAC name is 4,5-dimethylphenanthridin-5-ium;ethane.
Molecular Properties
| Compound Name | 4,5-dimethylphenanthridin-5-ium;ethane |
| PubChem CID | 142008491 |
| Molecular Formula | C17H20N+ |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 4,5-dimethylphenanthridin-5-ium;ethane |
| SMILES | CC.Cc1cccc2c3ccccc3c[n+](C)c12 |
| InChI | InChI=1S/C15H14N.C2H6/c1-11-6-5-9-14-13-8-4-3-7-12(13)10-16(2)15(11)14;1-2/h3-10H,1-2H3;1-2H3/q+1; |
| InChIKey | UVHUUBLMYFCKEH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethylphenanthridin-5-ium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethylphenanthridin-5-ium;ethane?
The IUPAC name of 4,5-dimethylphenanthridin-5-ium;ethane (CID 142008491) is 4,5-dimethylphenanthridin-5-ium;ethane.
What is the SMILES notation for 4,5-dimethylphenanthridin-5-ium;ethane?
The canonical SMILES for 4,5-dimethylphenanthridin-5-ium;ethane is CC.Cc1cccc2c3ccccc3c[n+](C)c12.
What is the InChIKey of 4,5-dimethylphenanthridin-5-ium;ethane?
The InChIKey is UVHUUBLMYFCKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N.C2H6/c1-11-6-5-9-14-13-8-4-3-7-12(13)10-16(2)15(11)14;1-2/h3-10H,1-2H3;1-2H3/q+1;.
What are the key properties of 4,5-dimethylphenanthridin-5-ium;ethane?
4,5-dimethylphenanthridin-5-ium;ethane has a molecular weight of 238.35 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethylphenanthridin-5-ium;ethane is sourced from PubChem (CID 142008491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).