C17H20N+ — CID 168990372
7-[(1Z)-buta-1,3-dienyl]-1,5,6,8-tetramethylquinolin-1-ium (PubChem CID 168990372) has the molecular formula C17H20N+ and a molecular weight of 238.35 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-1,5,6,8-tetramethylquinolin-1-ium.
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-1,5,6,8-tetramethylquinolin-1-ium |
|---|---|
| PubChem CID | 168990372 |
| Molecular Formula | C17H20N+ |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-1,5,6,8-tetramethylquinolin-1-ium |
| SMILES | C=C/C=C\c1c(C)c(C)c2ccc[n+](C)c2c1C |
| InChI | InChI=1S/C17H20N/c1-6-7-9-15-12(2)13(3)16-10-8-11-18(5)17(16)14(15)4/h6-11H,1H2,2-5H3/q+1/b9-7- |
| InChIKey | VMESNILDJQOYNF-CLFYSBASSA-N |
| XLogP | 3.79 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|