C18H14N2+2 — CID 159035687
13-methyl-1,13-diazoniapentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6,8,10,12,14,16-nonaene (PubChem CID 159035687) has the molecular formula C18H14N2+2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 13-methyl-1,13-diazoniapentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6,8,10,12,14,16-nonaene.
| Compound Name | 13-methyl-1,13-diazoniapentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6,8,10,12,14,16-nonaene |
|---|---|
| PubChem CID | 159035687 |
| Molecular Formula | C18H14N2+2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 13-methyl-1,13-diazoniapentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6,8,10,12,14,16-nonaene |
| SMILES | C[n+]1ccc2c3c1c1ccccc1c1ccc[n+](c13)C2 |
| InChI | InChI=1S/C18H14N2/c1-19-10-8-12-11-20-9-4-7-15-13-5-2-3-6-14(13)17(19)16(12)18(15)20/h2-10H,11H2,1H3/q+2 |
| InChIKey | YOXKQTUIPZTFQR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|