C11H11N3+2 — CID 159004332
2-methyl-12-aza-2,6-diazoniatetracyclo[8.2.1.04,12.06,11]trideca-1,3,6,8,10-pentaene (PubChem CID 159004332) has the molecular formula C11H11N3+2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-methyl-12-aza-2,6-diazoniatetracyclo[8.2.1.04,12.06,11]trideca-1,3,6,8,10-pentaene.
| Compound Name | 2-methyl-12-aza-2,6-diazoniatetracyclo[8.2.1.04,12.06,11]trideca-1,3,6,8,10-pentaene |
|---|---|
| PubChem CID | 159004332 |
| Molecular Formula | C11H11N3+2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 2-methyl-12-aza-2,6-diazoniatetracyclo[8.2.1.04,12.06,11]trideca-1,3,6,8,10-pentaene |
| SMILES | C[n+]1cc2n3c1Cc1ccc[n+](c1-3)C2 |
| InChI | InChI=1S/C11H11N3/c1-12-6-9-7-13-4-2-3-8-5-10(12)14(9)11(8)13/h2-4,6H,5,7H2,1H3/q+2 |
| InChIKey | GRPRSALWJXTQSV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|