C20H19BN2+2 — CID 158428268
3,19-dimethyl-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene (PubChem CID 158428268) has the molecular formula C20H19BN2+2 and a molecular weight of 298.20 g/mol. Its IUPAC name is 3,19-dimethyl-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene.
| Compound Name | 3,19-dimethyl-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 158428268 |
| Molecular Formula | C20H19BN2+2 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 3,19-dimethyl-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
| SMILES | C[n+]1cccc2c1B1c3c(cccc3Cc3ccc[n+](C)c31)C2 |
| InChI | InChI=1S/C20H19BN2/c1-22-10-4-8-16-12-14-6-3-7-15-13-17-9-5-11-23(2)20(17)21(18(14)15)19(16)22/h3-11H,12-13H2,1-2H3/q+2 |
| InChIKey | KNLUADPIMOEYDJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|