C22H18BN3+2 — CID 159195109
3,21-dimethyl-19-aza-3,21-diazonia-1-borahexacyclo[11.9.1.114,18.02,7.09,23.022,24]tetracosa-2(7),3,5,9(23),10,12,14(24),15,17,19,21-undecaene (PubChem CID 159195109) has the molecular formula C22H18BN3+2 and a molecular weight of 335.22 g/mol. Its IUPAC name is 3,21-dimethyl-19-aza-3,21-diazonia-1-borahexacyclo[11.9.1.114,18.02,7.09,23.022,24]tetracosa-2(7),3,5,9(23),10,12,14(24),15,17,19,21-undecaene.
| Compound Name | 3,21-dimethyl-19-aza-3,21-diazonia-1-borahexacyclo[11.9.1.114,18.02,7.09,23.022,24]tetracosa-2(7),3,5,9(23),10,12,14(24),15,17,19,21-undecaene |
|---|---|
| PubChem CID | 159195109 |
| Molecular Formula | C22H18BN3+2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3,21-dimethyl-19-aza-3,21-diazonia-1-borahexacyclo[11.9.1.114,18.02,7.09,23.022,24]tetracosa-2(7),3,5,9(23),10,12,14(24),15,17,19,21-undecaene |
| SMILES | C[n+]1cccc2c1B1c3c(cccc3-c3cccc4nc[n+](C)c1c34)C2 |
| InChI | InChI=1S/C22H18BN3/c1-25-11-5-7-15-12-14-6-3-9-17-16-8-4-10-18-19(16)22(26(2)13-24-18)23(20(14)17)21(15)25/h3-11,13H,12H2,1-2H3/q+2 |
| InChIKey | PQUIWLIUZSJHPY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 20.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|