C23H19BN4O+2 — CID 161075009
3,19-dimethyl-8-phenyl-14-oxa-8,10-diaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 161075009) has the molecular formula C23H19BN4O+2 and a molecular weight of 378.24 g/mol. Its IUPAC name is 3,19-dimethyl-8-phenyl-14-oxa-8,10-diaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 3,19-dimethyl-8-phenyl-14-oxa-8,10-diaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 161075009 |
| Molecular Formula | C23H19BN4O+2 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3,19-dimethyl-8-phenyl-14-oxa-8,10-diaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | C[n+]1cccc2c1B1c3c(ccnc3N(c3ccccc3)c3ccc[n+](C)c31)O2 |
| InChI | InChI=1S/C23H19BN4O/c1-26-14-6-10-17-21(26)24-20-18(29-19-11-7-15-27(2)22(19)24)12-13-25-23(20)28(17)16-8-4-3-5-9-16/h3-15H,1-2H3/q+2 |
| InChIKey | HKQVRESXBBPBMF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 33.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|