C26H26BN5O+2 — CID 157154642
11-tert-butyl-3,19-dimethyl-14-phenyl-8-oxa-10,12,14-triaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 157154642) has the molecular formula C26H26BN5O+2 and a molecular weight of 435.34 g/mol. Its IUPAC name is 11-tert-butyl-3,19-dimethyl-14-phenyl-8-oxa-10,12,14-triaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 11-tert-butyl-3,19-dimethyl-14-phenyl-8-oxa-10,12,14-triaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 157154642 |
| Molecular Formula | C26H26BN5O+2 |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 11-tert-butyl-3,19-dimethyl-14-phenyl-8-oxa-10,12,14-triaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | C[n+]1cccc2c1B1c3c(nc(C(C)(C)C)nc3N(c3ccccc3)c3ccc[n+](C)c31)O2 |
| InChI | InChI=1S/C26H26BN5O/c1-26(2,3)25-28-23-20-24(29-25)33-19-14-10-16-31(5)22(19)27(20)21-18(13-9-15-30(21)4)32(23)17-11-7-6-8-12-17/h6-16H,1-5H3/q+2 |
| InChIKey | RSWTWUVBWUPONC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|