C22H18BN5O+2 — CID 157391177
3,19-dimethyl-14-phenyl-8-oxa-6,14,16-triaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 157391177) has the molecular formula C22H18BN5O+2 and a molecular weight of 379.23 g/mol. Its IUPAC name is 3,19-dimethyl-14-phenyl-8-oxa-6,14,16-triaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 3,19-dimethyl-14-phenyl-8-oxa-6,14,16-triaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 157391177 |
| Molecular Formula | C22H18BN5O+2 |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3,19-dimethyl-14-phenyl-8-oxa-6,14,16-triaza-3,19-diazonia-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | C[n+]1ccnc2c1B1c3c(cccc3N(c3ccccc3)c3ncc[n+](C)c31)O2 |
| InChI | InChI=1S/C22H18BN5O/c1-26-13-11-24-21-19(26)23-18-16(28(21)15-7-4-3-5-8-15)9-6-10-17(18)29-22-20(23)27(2)14-12-25-22/h3-14H,1-2H3/q+2 |
| InChIKey | IUKMGKWRALXGES-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 46.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|