C54H33N9O3 — CID 147100386
10-[2-[3,5-bis(4-phenoxazin-10-ylpyrimidin-2-yl)phenyl]pyrimidin-4-yl]phenoxazine (PubChem CID 147100386) has the molecular formula C54H33N9O3 and a molecular weight of 855.92 g/mol. Its IUPAC name is 10-[2-[3,5-bis(4-phenoxazin-10-ylpyrimidin-2-yl)phenyl]pyrimidin-4-yl]phenoxazine.
| Compound Name | 10-[2-[3,5-bis(4-phenoxazin-10-ylpyrimidin-2-yl)phenyl]pyrimidin-4-yl]phenoxazine |
|---|---|
| PubChem CID | 147100386 |
| Molecular Formula | C54H33N9O3 |
| Molecular Weight | 855.92 g/mol |
| Exact Mass | 855.27 |
| IUPAC Name | 10-[2-[3,5-bis(4-phenoxazin-10-ylpyrimidin-2-yl)phenyl]pyrimidin-4-yl]phenoxazine |
| SMILES | c1ccc2c(c1)Oc1ccccc1N2c1ccnc(-c2cc(-c3nccc(N4c5ccccc5Oc5ccccc54)n3)cc(-c3nccc(N4c5ccccc5Oc5ccccc54)n3)c2)n1 |
| InChI | InChI=1S/C54H33N9O3/c1-7-19-43-37(13-1)61(38-14-2-8-20-44(38)64-43)49-25-28-55-52(58-49)34-31-35(53-56-29-26-50(59-53)62-39-15-3-9-21-45(39)65-46-22-10-4-16-40(46)62)33-36(32-34)54-57-30-27-51(60-54)63-41-17-5-11-23-47(41)66-48-24-12-6-18-42(48)63/h1-33H |
| InChIKey | BKNSDCPXKVCLKL-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 114.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.92 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |