C10H9N2+ — CID 58722687
2-aza-8-azoniatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene (PubChem CID 58722687) has the molecular formula C10H9N2+ and a molecular weight of 157.20 g/mol. Its IUPAC name is 2-aza-8-azoniatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene.
| Compound Name | 2-aza-8-azoniatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene |
|---|---|
| PubChem CID | 58722687 |
| Molecular Formula | C10H9N2+ |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.08 |
| IUPAC Name | 2-aza-8-azoniatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene |
| SMILES | c1cc[n+]2c(c1)-n1cccc1C2 |
| InChI | InChI=1S/C10H9N2/c1-2-6-11-8-9-4-3-7-12(9)10(11)5-1/h1-7H,8H2/q+1 |
| InChIKey | NCFQTLKIXCFHPY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|