C20H19N2O+ — CID 854640
(2S)-1-benzyl-2-phenyl-3H-imidazo[1,2-a]pyridin-4-ium-2-ol (PubChem CID 854640) has the molecular formula C20H19N2O+ and a molecular weight of 303.39 g/mol. Its IUPAC name is (2S)-1-benzyl-2-phenyl-3H-imidazo[1,2-a]pyridin-4-ium-2-ol.
| Compound Name | (2S)-1-benzyl-2-phenyl-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
|---|---|
| PubChem CID | 854640 |
| Molecular Formula | C20H19N2O+ |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (2S)-1-benzyl-2-phenyl-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
| SMILES | O[C@@]1(c2ccccc2)C[n+]2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C20H19N2O/c23-20(18-11-5-2-6-12-18)16-21-14-8-7-13-19(21)22(20)15-17-9-3-1-4-10-17/h1-14,23H,15-16H2/q+1/t20-/m1/s1 |
| InChIKey | PWHFFJAUSAPAAW-HXUWFJFHSA-N |
| XLogP | 2.84 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|