About (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol
(2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol (PubChem CID 34637337) has the molecular formula C21H21N2O2+
and a molecular weight of 333.41 g/mol. Its IUPAC name is (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol.
Molecular Properties
| Compound Name | (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
| PubChem CID | 34637337 |
| Molecular Formula | C21H21N2O2+ |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
| SMILES | COc1ccc([C@@]2(O)C[n+]3ccccc3N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N2O2/c1-25-19-12-10-18(11-13-19)21(24)16-22-14-6-5-9-20(22)23(21)15-17-7-3-2-4-8-17/h2-14,24H,15-16H2,1H3/q+1/t21-/m0/s1 |
| InChIKey | CPQSXHILNMULLA-NRFANRHFSA-N |
| XLogP | 2.85 |
| TPSA | 36.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol?
The IUPAC name of (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol (CID 34637337) is (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol.
What is the SMILES notation for (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol?
The canonical SMILES for (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol is COc1ccc([C@@]2(O)C[n+]3ccccc3N2Cc2ccccc2)cc1.
What is the InChIKey of (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol?
The InChIKey is CPQSXHILNMULLA-NRFANRHFSA-N. The full InChI is InChI=1S/C21H21N2O2/c1-25-19-12-10-18(11-13-19)21(24)16-22-14-6-5-9-20(22)23(21)15-17-7-3-2-4-8-17/h2-14,24H,15-16H2,1H3/q+1/t21-/m0/s1.
What are the key properties of (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol?
(2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol has a molecular weight of 333.41 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-benzyl-2-(4-methoxyphenyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-ol is sourced from PubChem (CID 34637337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).