About 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol
1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol (PubChem CID 67300619) has the molecular formula C19H17N4O3+
and a molecular weight of 349.37 g/mol. Its IUPAC name is 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol.
Molecular Properties
| Compound Name | 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
| PubChem CID | 67300619 |
| Molecular Formula | C19H17N4O3+ |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
| SMILES | O=[N+]([O-])c1ccc(C2(O)C[n+]3cccnc3N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H17N4O3/c24-19(16-7-9-17(10-8-16)23(25)26)14-21-12-4-11-20-18(21)22(19)13-15-5-2-1-3-6-15/h1-12,24H,13-14H2/q+1 |
| InChIKey | ZBJITOSRGQYUAH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol?
The IUPAC name of 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol (CID 67300619) is 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol.
What is the SMILES notation for 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol?
The canonical SMILES for 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol is O=[N+]([O-])c1ccc(C2(O)C[n+]3cccnc3N2Cc2ccccc2)cc1.
What is the InChIKey of 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol?
The InChIKey is ZBJITOSRGQYUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N4O3/c24-19(16-7-9-17(10-8-16)23(25)26)14-21-12-4-11-20-18(21)22(19)13-15-5-2-1-3-6-15/h1-12,24H,13-14H2/q+1.
What are the key properties of 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol?
1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol has a molecular weight of 349.37 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol is sourced from PubChem (CID 67300619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).