C22H23BrN4O5 — CID 67300518
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (PubChem CID 67300518) has the molecular formula C22H23BrN4O5 and a molecular weight of 503.35 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
|---|---|
| PubChem CID | 67300518 |
| Molecular Formula | C22H23BrN4O5 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| SMILES | COc1ccc(CCN2c3nccc[n+]3CC2(O)c2ccc([N+](=O)[O-])cc2)cc1OC.[Br-] |
| InChI | InChI=1S/C22H23N4O5.BrH/c1-30-19-9-4-16(14-20(19)31-2)10-13-25-21-23-11-3-12-24(21)15-22(25,27)17-5-7-18(8-6-17)26(28)29;/h3-9,11-12,14,27H,10,13,15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | TVJRWHZNEZYFOD-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|