C14H13Cl2N6O+ — CID 71236812
1-(2-azidoethyl)-2-(3,4-dichlorophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol (PubChem CID 71236812) has the molecular formula C14H13Cl2N6O+ and a molecular weight of 352.21 g/mol. Its IUPAC name is 1-(2-azidoethyl)-2-(3,4-dichlorophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol.
| Compound Name | 1-(2-azidoethyl)-2-(3,4-dichlorophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
|---|---|
| PubChem CID | 71236812 |
| Molecular Formula | C14H13Cl2N6O+ |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(2-azidoethyl)-2-(3,4-dichlorophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
| SMILES | [N-]=[N+]=NCCN1c2nccc[n+]2CC1(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N6O/c15-11-3-2-10(8-12(11)16)14(23)9-21-6-1-4-18-13(21)22(14)7-5-19-20-17/h1-4,6,8,23H,5,7,9H2/q+1 |
| InChIKey | LRELQYVGAYVWRQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|