C15H15Cl2N6O+ — CID 71236797
1-(3-azidopropyl)-2-(3,4-dichlorophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol (PubChem CID 71236797) has the molecular formula C15H15Cl2N6O+ and a molecular weight of 366.23 g/mol. Its IUPAC name is 1-(3-azidopropyl)-2-(3,4-dichlorophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol.
| Compound Name | 1-(3-azidopropyl)-2-(3,4-dichlorophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
|---|---|
| PubChem CID | 71236797 |
| Molecular Formula | C15H15Cl2N6O+ |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-(3-azidopropyl)-2-(3,4-dichlorophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
| SMILES | [N-]=[N+]=NCCCN1c2nccc[n+]2CC1(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N6O/c16-12-4-3-11(9-13(12)17)15(24)10-22-7-1-5-19-14(22)23(15)8-2-6-20-21-18/h1,3-5,7,9,24H,2,6,8,10H2/q+1 |
| InChIKey | YIYSICMOQIXNAG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|