C22H23BrN6O — CID 71236947
1-(4-azidobutyl)-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (PubChem CID 71236947) has the molecular formula C22H23BrN6O and a molecular weight of 467.37 g/mol. Its IUPAC name is 1-(4-azidobutyl)-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
| Compound Name | 1-(4-azidobutyl)-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
|---|---|
| PubChem CID | 71236947 |
| Molecular Formula | C22H23BrN6O |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 1-(4-azidobutyl)-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| SMILES | [Br-].[N-]=[N+]=NCCCCN1c2nccc[n+]2C(c2ccccc2)C1(O)c1ccccc1 |
| InChI | InChI=1S/C22H23N6O.BrH/c23-26-25-15-7-8-17-28-21-24-14-9-16-27(21)20(18-10-3-1-4-11-18)22(28,29)19-12-5-2-6-13-19;/h1-6,9-14,16,20,29H,7-8,15,17H2;1H/q+1;/p-1 |
| InChIKey | ZGBJGQVBNVZLLF-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|