C26H31N4O3+ — CID 56678700
(2S)-2-[4-(4-nitrophenyl)phenyl]-1-octyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol (PubChem CID 56678700) has the molecular formula C26H31N4O3+ and a molecular weight of 447.56 g/mol. Its IUPAC name is (2S)-2-[4-(4-nitrophenyl)phenyl]-1-octyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol.
| Compound Name | (2S)-2-[4-(4-nitrophenyl)phenyl]-1-octyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
|---|---|
| PubChem CID | 56678700 |
| Molecular Formula | C26H31N4O3+ |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (2S)-2-[4-(4-nitrophenyl)phenyl]-1-octyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
| SMILES | CCCCCCCCN1c2nccc[n+]2C[C@@]1(O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H31N4O3/c1-2-3-4-5-6-7-19-29-25-27-17-8-18-28(25)20-26(29,31)23-13-9-21(10-14-23)22-11-15-24(16-12-22)30(32)33/h8-18,31H,2-7,19-20H2,1H3/q+1/t26-/m1/s1 |
| InChIKey | SHEVHDAEQQGJSN-AREMUKBSSA-N |
| XLogP | 4.97 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|