C16H19N4O3+ — CID 56668509
(2S)-1-tert-butyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol (PubChem CID 56668509) has the molecular formula C16H19N4O3+ and a molecular weight of 315.35 g/mol. Its IUPAC name is (2S)-1-tert-butyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol.
| Compound Name | (2S)-1-tert-butyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
|---|---|
| PubChem CID | 56668509 |
| Molecular Formula | C16H19N4O3+ |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2S)-1-tert-butyl-2-(4-nitrophenyl)-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
| SMILES | CC(C)(C)N1c2nccc[n+]2C[C@@]1(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19N4O3/c1-15(2,3)19-14-17-9-4-10-18(14)11-16(19,21)12-5-7-13(8-6-12)20(22)23/h4-10,21H,11H2,1-3H3/q+1/t16-/m1/s1 |
| InChIKey | RVIJXNKAJYKMCS-MRXNPFEDSA-N |
| XLogP | 1.74 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|