C15H17N4O3+ — CID 56661638
(2S)-2-(4-nitrophenyl)-1-propan-2-yl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol (PubChem CID 56661638) has the molecular formula C15H17N4O3+ and a molecular weight of 301.33 g/mol. Its IUPAC name is (2S)-2-(4-nitrophenyl)-1-propan-2-yl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol.
| Compound Name | (2S)-2-(4-nitrophenyl)-1-propan-2-yl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
|---|---|
| PubChem CID | 56661638 |
| Molecular Formula | C15H17N4O3+ |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (2S)-2-(4-nitrophenyl)-1-propan-2-yl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
| SMILES | CC(C)N1c2nccc[n+]2C[C@@]1(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17N4O3/c1-11(2)18-14-16-8-3-9-17(14)10-15(18,20)12-4-6-13(7-5-12)19(21)22/h3-9,11,20H,10H2,1-2H3/q+1/t15-/m1/s1 |
| InChIKey | PIZZOWPTFVJZAD-OAHLLOKOSA-N |
| XLogP | 1.35 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|