C20H18N3O3+ — CID 123369150
(2S)-1-(1,3-benzodioxol-5-ylmethyl)-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol (PubChem CID 123369150) has the molecular formula C20H18N3O3+ and a molecular weight of 348.38 g/mol. Its IUPAC name is (2S)-1-(1,3-benzodioxol-5-ylmethyl)-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol.
| Compound Name | (2S)-1-(1,3-benzodioxol-5-ylmethyl)-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
|---|---|
| PubChem CID | 123369150 |
| Molecular Formula | C20H18N3O3+ |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2S)-1-(1,3-benzodioxol-5-ylmethyl)-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol |
| SMILES | O[C@@]1(c2ccccc2)C[n+]2cccnc2N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18N3O3/c24-20(16-5-2-1-3-6-16)13-22-10-4-9-21-19(22)23(20)12-15-7-8-17-18(11-15)26-14-25-17/h1-11,24H,12-14H2/q+1/t20-/m1/s1 |
| InChIKey | GUSIHZOVFNNGGW-HXUWFJFHSA-N |
| XLogP | 1.96 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|