C20H17N3O3 — CID 171975434
N-(1,3-benzodioxol-5-ylmethyl)-N'-phenylpyridine-2-carbohydrazide (PubChem CID 171975434) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-phenylpyridine-2-carbohydrazide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-phenylpyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 171975434 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-phenylpyridine-2-carbohydrazide |
| SMILES | O=C(c1ccccn1)N(Cc1ccc2c(c1)OCO2)Nc1ccccc1 |
| InChI | InChI=1S/C20H17N3O3/c24-20(17-8-4-5-11-21-17)23(22-16-6-2-1-3-7-16)13-15-9-10-18-19(12-15)26-14-25-18/h1-12,22H,13-14H2 |
| InChIKey | ZGJMXNBTPSCOBY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|