C23H23N3O4 — CID 95803111
N-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-N-(furan-2-ylmethyl)pyridine-2-carboxamide (PubChem CID 95803111) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-N-(furan-2-ylmethyl)pyridine-2-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-N-(furan-2-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 95803111 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-N-(furan-2-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(c1ccccn1)N(Cc1ccco1)C1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H23N3O4/c27-23(20-5-1-2-10-24-20)26(15-19-4-3-13-28-19)17-8-11-25(12-9-17)18-6-7-21-22(14-18)30-16-29-21/h1-7,10,13-14,17H,8-9,11-12,15-16H2 |
| InChIKey | OFBZNUZLJKARPN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|