C18H24N2O5 — CID 125180638
(1R,4S,5R,7S,11S)-3-tert-butyl-5-(4-nitrophenyl)-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecan-5-ol (PubChem CID 125180638) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is (1R,4S,5R,7S,11S)-3-tert-butyl-5-(4-nitrophenyl)-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecan-5-ol.
| Compound Name | (1R,4S,5R,7S,11S)-3-tert-butyl-5-(4-nitrophenyl)-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecan-5-ol |
|---|---|
| PubChem CID | 125180638 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (1R,4S,5R,7S,11S)-3-tert-butyl-5-(4-nitrophenyl)-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecan-5-ol |
| SMILES | CC(C)(C)N1O[C@@H]2CCC[C@@H]3O[C@](O)(c4ccc([N+](=O)[O-])cc4)[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C18H24N2O5/c1-17(2,3)19-16-15-13(5-4-6-14(15)25-19)24-18(16,21)11-7-9-12(10-8-11)20(22)23/h7-10,13-16,21H,4-6H2,1-3H3/t13-,14+,15-,16-,18+/m0/s1 |
| InChIKey | IRDKYVHOQJXZCG-ULQWZQFMSA-N |
| XLogP | 2.72 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|