C15H20N2O5 — CID 5019427
1-tert-butyl-6-(4-nitrophenyl)-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-ol (PubChem CID 5019427) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-tert-butyl-6-(4-nitrophenyl)-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-ol.
| Compound Name | 1-tert-butyl-6-(4-nitrophenyl)-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-ol |
|---|---|
| PubChem CID | 5019427 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-tert-butyl-6-(4-nitrophenyl)-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-ol |
| SMILES | CC(C)(C)N1OCC2COC(O)(c3ccc([N+](=O)[O-])cc3)C21 |
| InChI | InChI=1S/C15H20N2O5/c1-14(2,3)16-13-10(9-22-16)8-21-15(13,18)11-4-6-12(7-5-11)17(19)20/h4-7,10,13,18H,8-9H2,1-3H3 |
| InChIKey | SMEISUOGAMZPQO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|