C17H17NOS — CID 139469582
3-benzyl-2-methylidene-4-phenyl-1,3-thiazolidin-4-ol (PubChem CID 139469582) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-benzyl-2-methylidene-4-phenyl-1,3-thiazolidin-4-ol.
| Compound Name | 3-benzyl-2-methylidene-4-phenyl-1,3-thiazolidin-4-ol |
|---|---|
| PubChem CID | 139469582 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-benzyl-2-methylidene-4-phenyl-1,3-thiazolidin-4-ol |
| SMILES | C=C1SCC(O)(c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H17NOS/c1-14-18(12-15-8-4-2-5-9-15)17(19,13-20-14)16-10-6-3-7-11-16/h2-11,19H,1,12-13H2 |
| InChIKey | IFEGSRVQGWUJGD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |