C18H18O2 — CID 10967455
cis-(1R,2S)-4-methylidene-1,2-diphenylcyclopentane-1,2-diol (PubChem CID 10967455) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is cis-(1R,2S)-4-methylidene-1,2-diphenylcyclopentane-1,2-diol.
| Compound Name | cis-(1R,2S)-4-methylidene-1,2-diphenylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 10967455 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | cis-(1R,2S)-4-methylidene-1,2-diphenylcyclopentane-1,2-diol |
| SMILES | C=C1C[C@@](O)(c2ccccc2)[C@@](O)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H18O2/c1-14-12-17(19,15-8-4-2-5-9-15)18(20,13-14)16-10-6-3-7-11-16/h2-11,19-20H,1,12-13H2/t17-,18+ |
| InChIKey | PLRBVHWPFQXUCF-HDICACEKSA-N |
| XLogP | 3.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|