C13H16O2 — CID 10987365
(1R,2S)-1-methyl-2-phenylcyclohex-4-ene-1,2-diol (PubChem CID 10987365) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (1R,2S)-1-methyl-2-phenylcyclohex-4-ene-1,2-diol.
| Compound Name | (1R,2S)-1-methyl-2-phenylcyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 10987365 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (1R,2S)-1-methyl-2-phenylcyclohex-4-ene-1,2-diol |
| SMILES | C[C@@]1(O)CC=CC[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-12(14)9-5-6-10-13(12,15)11-7-3-2-4-8-11/h2-8,14-15H,9-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | GLZLFHDZKPRKNW-OLZOCXBDSA-N |
| XLogP | 1.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|