C15H22N2O3S2 — CID 21121977
3-benzyl-4-hydroxy-2-sulfanylidene-1,3-thiazolidine-4-carboxylic acid;N-ethylethanamine (PubChem CID 21121977) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-benzyl-4-hydroxy-2-sulfanylidene-1,3-thiazolidine-4-carboxylic acid;N-ethylethanamine.
| Compound Name | 3-benzyl-4-hydroxy-2-sulfanylidene-1,3-thiazolidine-4-carboxylic acid;N-ethylethanamine |
|---|---|
| PubChem CID | 21121977 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-benzyl-4-hydroxy-2-sulfanylidene-1,3-thiazolidine-4-carboxylic acid;N-ethylethanamine |
| SMILES | CCNCC.O=C(O)C1(O)CSC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C11H11NO3S2.C4H11N/c13-9(14)11(15)7-17-10(16)12(11)6-8-4-2-1-3-5-8;1-3-5-4-2/h1-5,15H,6-7H2,(H,13,14);5H,3-4H2,1-2H3 |
| InChIKey | QXCYXOILFBHSCW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|