C15H22N2OS — CID 39354593
(6R)-1-benzyl-6-hydroxy-3,4,4,6-tetramethyl-1,3-diazinane-2-thione (PubChem CID 39354593) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is (6R)-1-benzyl-6-hydroxy-3,4,4,6-tetramethyl-1,3-diazinane-2-thione.
| Compound Name | (6R)-1-benzyl-6-hydroxy-3,4,4,6-tetramethyl-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 39354593 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (6R)-1-benzyl-6-hydroxy-3,4,4,6-tetramethyl-1,3-diazinane-2-thione |
| SMILES | CN1C(=S)N(Cc2ccccc2)[C@](C)(O)CC1(C)C |
| InChI | InChI=1S/C15H22N2OS/c1-14(2)11-15(3,18)17(13(19)16(14)4)10-12-8-6-5-7-9-12/h5-9,18H,10-11H2,1-4H3/t15-/m1/s1 |
| InChIKey | KWXZJHGWNSVYIQ-OAHLLOKOSA-N |
| XLogP | 2.60 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|