C26H26N2S — CID 122394347
2-benzyl-7a-methyl-6,6-diphenyl-5,7-dihydro-1H-pyrrolo[1,2-c]imidazole-3-thione (PubChem CID 122394347) has the molecular formula C26H26N2S and a molecular weight of 398.58 g/mol. Its IUPAC name is 2-benzyl-7a-methyl-6,6-diphenyl-5,7-dihydro-1H-pyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | 2-benzyl-7a-methyl-6,6-diphenyl-5,7-dihydro-1H-pyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 122394347 |
| Molecular Formula | C26H26N2S |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-benzyl-7a-methyl-6,6-diphenyl-5,7-dihydro-1H-pyrrolo[1,2-c]imidazole-3-thione |
| SMILES | CC12CN(Cc3ccccc3)C(=S)N1CC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C26H26N2S/c1-25-18-26(22-13-7-3-8-14-22,23-15-9-4-10-16-23)20-28(25)24(29)27(19-25)17-21-11-5-2-6-12-21/h2-16H,17-20H2,1H3 |
| InChIKey | FYKJOOQDFHCLBJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|