C21H22N2O — CID 102198649
2-(1-acetyl-2-methyl-4,4-diphenylpyrrolidin-2-yl)acetonitrile (PubChem CID 102198649) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(1-acetyl-2-methyl-4,4-diphenylpyrrolidin-2-yl)acetonitrile.
| Compound Name | 2-(1-acetyl-2-methyl-4,4-diphenylpyrrolidin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 102198649 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-(1-acetyl-2-methyl-4,4-diphenylpyrrolidin-2-yl)acetonitrile |
| SMILES | CC(=O)N1CC(c2ccccc2)(c2ccccc2)CC1(C)CC#N |
| InChI | InChI=1S/C21H22N2O/c1-17(24)23-16-21(15-20(23,2)13-14-22,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12H,13,15-16H2,1-2H3 |
| InChIKey | GZKLLIWHIVWEJS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |