C20H19N3 — CID 122202882
1-(cyanomethyl)-2-methyl-4,4-diphenylpyrrolidine-2-carbonitrile (PubChem CID 122202882) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(cyanomethyl)-2-methyl-4,4-diphenylpyrrolidine-2-carbonitrile.
| Compound Name | 1-(cyanomethyl)-2-methyl-4,4-diphenylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 122202882 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-(cyanomethyl)-2-methyl-4,4-diphenylpyrrolidine-2-carbonitrile |
| SMILES | CC1(C#N)CC(c2ccccc2)(c2ccccc2)CN1CC#N |
| InChI | InChI=1S/C20H19N3/c1-19(15-22)14-20(16-23(19)13-12-21,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11H,13-14,16H2,1H3 |
| InChIKey | OPTAVVJOGAGRCE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|