C17H15N3 — CID 101094034
3-methyl-5,5-diphenyl-4H-pyrazole-3-carbonitrile (PubChem CID 101094034) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 3-methyl-5,5-diphenyl-4H-pyrazole-3-carbonitrile.
| Compound Name | 3-methyl-5,5-diphenyl-4H-pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 101094034 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-methyl-5,5-diphenyl-4H-pyrazole-3-carbonitrile |
| SMILES | CC1(C#N)CC(c2ccccc2)(c2ccccc2)N=N1 |
| InChI | InChI=1S/C17H15N3/c1-16(13-18)12-17(20-19-16,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11H,12H2,1H3 |
| InChIKey | XPNWNCVJYWHPOH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |