C14H16BrN — CID 101087031
(1S,5R)-3-benzyl-1-bromo-5-methyl-2-methylidene-3-azabicyclo[3.1.0]hexane (PubChem CID 101087031) has the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. Its IUPAC name is (1S,5R)-3-benzyl-1-bromo-5-methyl-2-methylidene-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-3-benzyl-1-bromo-5-methyl-2-methylidene-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 101087031 |
| Molecular Formula | C14H16BrN |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | (1S,5R)-3-benzyl-1-bromo-5-methyl-2-methylidene-3-azabicyclo[3.1.0]hexane |
| SMILES | C=C1N(Cc2ccccc2)C[C@@]2(C)C[C@@]12Br |
| InChI | InChI=1S/C14H16BrN/c1-11-14(15)9-13(14,2)10-16(11)8-12-6-4-3-5-7-12/h3-7H,1,8-10H2,2H3/t13-,14-/m1/s1 |
| InChIKey | CEAKDAPUGUJRCO-ZIAGYGMSSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|