C18H16N2OS2 — CID 149056885
4-hydroxy-3-(3H-indol-2-ylmethyl)-4-phenyl-1,3-thiazolidine-2-thione (PubChem CID 149056885) has the molecular formula C18H16N2OS2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-hydroxy-3-(3H-indol-2-ylmethyl)-4-phenyl-1,3-thiazolidine-2-thione.
| Compound Name | 4-hydroxy-3-(3H-indol-2-ylmethyl)-4-phenyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 149056885 |
| Molecular Formula | C18H16N2OS2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-hydroxy-3-(3H-indol-2-ylmethyl)-4-phenyl-1,3-thiazolidine-2-thione |
| SMILES | OC1(c2ccccc2)CSC(=S)N1CC1=Nc2ccccc2C1 |
| InChI | InChI=1S/C18H16N2OS2/c21-18(14-7-2-1-3-8-14)12-23-17(22)20(18)11-15-10-13-6-4-5-9-16(13)19-15/h1-9,21H,10-12H2 |
| InChIKey | QLABXQKSEUXGBR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|