C27H24N4 — CID 170003747
1-(3H-indol-2-yl)-N,N-bis(3H-indol-2-ylmethyl)methanamine (PubChem CID 170003747) has the molecular formula C27H24N4 and a molecular weight of 404.52 g/mol. Its IUPAC name is 1-(3H-indol-2-yl)-N,N-bis(3H-indol-2-ylmethyl)methanamine.
| Compound Name | 1-(3H-indol-2-yl)-N,N-bis(3H-indol-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 170003747 |
| Molecular Formula | C27H24N4 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-(3H-indol-2-yl)-N,N-bis(3H-indol-2-ylmethyl)methanamine |
| SMILES | c1ccc2c(c1)CC(CN(CC1=Nc3ccccc3C1)CC1=Nc3ccccc3C1)=N2 |
| InChI | InChI=1S/C27H24N4/c1-4-10-25-19(7-1)13-22(28-25)16-31(17-23-14-20-8-2-5-11-26(20)29-23)18-24-15-21-9-3-6-12-27(21)30-24/h1-12H,13-18H2 |
| InChIKey | AOQVERRYSAUAMS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |