C7H10N2O5S — CID 135959467
hydrogen sulfate;(NE)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine (PubChem CID 135959467) has the molecular formula C7H10N2O5S and a molecular weight of 234.23 g/mol. Its IUPAC name is hydrogen sulfate;(NE)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine.
| Compound Name | hydrogen sulfate;(NE)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135959467 |
| Molecular Formula | C7H10N2O5S |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | hydrogen sulfate;(NE)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine |
| SMILES | C[n+]1ccccc1/C=N/O.O=S(=O)([O-])O |
| InChI | InChI=1S/C7H8N2O.H2O4S/c1-9-5-3-2-4-7(9)6-8-10;1-5(2,3)4/h2-6H,1H3;(H2,1,2,3,4) |
| InChIKey | KCBOCPKPKVNVBY-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 113.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|