C14H18N4O11S2 — CID 135928232
hydrogen sulfate;(NE)-N-[[1-[[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine (PubChem CID 135928232) has the molecular formula C14H18N4O11S2 and a molecular weight of 482.45 g/mol. Its IUPAC name is hydrogen sulfate;(NE)-N-[[1-[[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine.
| Compound Name | hydrogen sulfate;(NE)-N-[[1-[[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135928232 |
| Molecular Formula | C14H18N4O11S2 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | hydrogen sulfate;(NE)-N-[[1-[[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1cc[n+](COC[n+]2ccc(/C=N/O)cc2)cc1.O=S(=O)([O-])O.O=S(=O)([O-])O |
| InChI | InChI=1S/C14H14N4O3.2H2O4S/c19-15-9-13-1-5-17(6-2-13)11-21-12-18-7-3-14(4-8-18)10-16-20;2*1-5(2,3)4/h1-10H,11-12H2;2*(H2,1,2,3,4) |
| InChIKey | LSHKMQLPCKVQIS-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 237.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|