C15H19Cl2N3O2S — CID 135770166
(NZ)-N-[[1-[(4-ethylsulfanylpyridin-1-ium-1-yl)methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dichloride (PubChem CID 135770166) has the molecular formula C15H19Cl2N3O2S and a molecular weight of 376.31 g/mol. Its IUPAC name is (NZ)-N-[[1-[(4-ethylsulfanylpyridin-1-ium-1-yl)methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dichloride.
| Compound Name | (NZ)-N-[[1-[(4-ethylsulfanylpyridin-1-ium-1-yl)methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dichloride |
|---|---|
| PubChem CID | 135770166 |
| Molecular Formula | C15H19Cl2N3O2S |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (NZ)-N-[[1-[(4-ethylsulfanylpyridin-1-ium-1-yl)methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dichloride |
| SMILES | CCSc1cc[n+](COC[n+]2ccc(/C=N\O)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C15H18N3O2S.2ClH/c1-2-21-15-5-9-18(10-6-15)13-20-12-17-7-3-14(4-8-17)11-16-19;;/h3-11H,2,12-13H2,1H3;2*1H/q+1;;/p-1 |
| InChIKey | KRHSDTGFEPBZFJ-UHFFFAOYSA-M |
| XLogP | -4.18 |
| TPSA | 49.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|