C28H23BN5OP — CID 135686905
CID 135686905 (PubChem CID 135686905) has the molecular formula C28H23BN5OP and a molecular weight of 487.31 g/mol.
| Compound Name | CID 135686905 |
|---|---|
| PubChem CID | 135686905 |
| Molecular Formula | C28H23BN5OP |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | — |
| SMILES | [B]P(C)n1nc(-c2nc3ccccc3[nH]2)c2cc(-c3cncc(-c4cccc(CO)c4)c3C)ccc21 |
| InChI | InChI=1S/C28H23BN5OP/c1-17-22(19-7-5-6-18(12-19)16-35)14-30-15-23(17)20-10-11-26-21(13-20)27(33-34(26)36(2)29)28-31-24-8-3-4-9-25(24)32-28/h3-15,35H,16H2,1-2H3,(H,31,32) |
| InChIKey | XKHSJVZWRAZFTH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|